C16H36N2O — CID 62256428
2-[butyl-[2-methyl-2-[(propan-2-ylamino)methyl]pentyl]amino]ethanol (PubChem CID 62256428) has the molecular formula C16H36N2O and a molecular weight of 272.48 g/mol. Its IUPAC name is 2-[butyl-[2-methyl-2-[(propan-2-ylamino)methyl]pentyl]amino]ethanol.
| Compound Name | 2-[butyl-[2-methyl-2-[(propan-2-ylamino)methyl]pentyl]amino]ethanol |
|---|---|
| PubChem CID | 62256428 |
| Molecular Formula | C16H36N2O |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.28 |
| IUPAC Name | 2-[butyl-[2-methyl-2-[(propan-2-ylamino)methyl]pentyl]amino]ethanol |
| SMILES | CCCCN(CCO)CC(C)(CCC)CNC(C)C |
| InChI | InChI=1S/C16H36N2O/c1-6-8-10-18(11-12-19)14-16(5,9-7-2)13-17-15(3)4/h15,17,19H,6-14H2,1-5H3 |
| InChIKey | SOFBDEYKBLFBSB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |