C16H36N2O — CID 63690537
N-(2-ethoxyethyl)-N-ethyl-2-methyl-N'-propan-2-yl-2-propylpropane-1,3-diamine (PubChem CID 63690537) has the molecular formula C16H36N2O and a molecular weight of 272.48 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N-ethyl-2-methyl-N'-propan-2-yl-2-propylpropane-1,3-diamine.
| Compound Name | N-(2-ethoxyethyl)-N-ethyl-2-methyl-N'-propan-2-yl-2-propylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63690537 |
| Molecular Formula | C16H36N2O |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.28 |
| IUPAC Name | N-(2-ethoxyethyl)-N-ethyl-2-methyl-N'-propan-2-yl-2-propylpropane-1,3-diamine |
| SMILES | CCCC(C)(CNC(C)C)CN(CC)CCOCC |
| InChI | InChI=1S/C16H36N2O/c1-7-10-16(6,13-17-15(4)5)14-18(8-2)11-12-19-9-3/h15,17H,7-14H2,1-6H3 |
| InChIKey | RJFWGNPVXLHOQF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|