C15H30N2O2 — CID 62257157
N-[[3-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-yl]methyl]propan-1-amine (PubChem CID 62257157) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-[[3-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[3-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62257157 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | N-[[3-[(2,5-dimethylmorpholin-4-yl)methyl]oxolan-3-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1(CN2CC(C)OCC2C)CCOC1 |
| InChI | InChI=1S/C15H30N2O2/c1-4-6-16-10-15(5-7-18-12-15)11-17-8-14(3)19-9-13(17)2/h13-14,16H,4-12H2,1-3H3 |
| InChIKey | YHVIJRBNKHFTLC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|