C16H30N2S — CID 62258945
2,2-dimethyl-N-propan-2-yl-N'-propyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine (PubChem CID 62258945) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is 2,2-dimethyl-N-propan-2-yl-N'-propyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine.
| Compound Name | 2,2-dimethyl-N-propan-2-yl-N'-propyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62258945 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 2,2-dimethyl-N-propan-2-yl-N'-propyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine |
| SMILES | CCCNCC(C)(C)CN(Cc1cccs1)C(C)C |
| InChI | InChI=1S/C16H30N2S/c1-6-9-17-12-16(4,5)13-18(14(2)3)11-15-8-7-10-19-15/h7-8,10,14,17H,6,9,11-13H2,1-5H3 |
| InChIKey | CLHUISLGPFIQSR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|