C16H30N2S — CID 62259654
N,2-diethyl-2-methyl-N'-propyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine (PubChem CID 62259654) has the molecular formula C16H30N2S and a molecular weight of 282.50 g/mol. Its IUPAC name is N,2-diethyl-2-methyl-N'-propyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N,2-diethyl-2-methyl-N'-propyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62259654 |
| Molecular Formula | C16H30N2S |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N,2-diethyl-2-methyl-N'-propyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine |
| SMILES | CCCNCC(C)(CC)CN(CC)Cc1cccs1 |
| InChI | InChI=1S/C16H30N2S/c1-5-10-17-13-16(4,6-2)14-18(7-3)12-15-9-8-11-19-15/h8-9,11,17H,5-7,10,12-14H2,1-4H3 |
| InChIKey | QBEMPXXDBIVFHJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|