About N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine
N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine (PubChem CID 62261000) has the molecular formula C17H39N3
and a molecular weight of 285.52 g/mol. Its IUPAC name is N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine |
| PubChem CID | 62261000 |
| Molecular Formula | C17H39N3 |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.31 |
| IUPAC Name | N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine |
| SMILES | CCCN(CCN(C)C)CC(C)(CC)CNC(C)(C)C |
| InChI | InChI=1S/C17H39N3/c1-9-11-20(13-12-19(7)8)15-17(6,10-2)14-18-16(3,4)5/h18H,9-15H2,1-8H3 |
| InChIKey | OBYQDGVENJNGLY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine?
The IUPAC name of N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine (CID 62261000) is N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine.
What is the SMILES notation for N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine?
The canonical SMILES for N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine is CCCN(CCN(C)C)CC(C)(CC)CNC(C)(C)C.
What is the InChIKey of N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine?
The InChIKey is OBYQDGVENJNGLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H39N3/c1-9-11-20(13-12-19(7)8)15-17(6,10-2)14-18-16(3,4)5/h18H,9-15H2,1-8H3.
What are the key properties of N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine?
N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine has a molecular weight of 285.52 g/mol, XLogP of 3.06, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N'-[2-(dimethylamino)ethyl]-2-ethyl-2-methyl-N'-propylpropane-1,3-diamine is sourced from PubChem (CID 62261000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).