C16H37N3 — CID 55072277
N-tert-butyl-N'-[2-(dimethylamino)ethyl]-N'-propylpentane-1,5-diamine (PubChem CID 55072277) has the molecular formula C16H37N3 and a molecular weight of 271.49 g/mol. Its IUPAC name is N-tert-butyl-N'-[2-(dimethylamino)ethyl]-N'-propylpentane-1,5-diamine.
| Compound Name | N-tert-butyl-N'-[2-(dimethylamino)ethyl]-N'-propylpentane-1,5-diamine |
|---|---|
| PubChem CID | 55072277 |
| Molecular Formula | C16H37N3 |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 271.30 |
| IUPAC Name | N-tert-butyl-N'-[2-(dimethylamino)ethyl]-N'-propylpentane-1,5-diamine |
| SMILES | CCCN(CCCCCNC(C)(C)C)CCN(C)C |
| InChI | InChI=1S/C16H37N3/c1-7-12-19(15-14-18(5)6)13-10-8-9-11-17-16(2,3)4/h17H,7-15H2,1-6H3 |
| InChIKey | NOJJOWACGQPUOQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|