C13H27F3N2 — CID 62425905
N-tert-butyl-N'-ethyl-N'-(2,2,2-trifluoroethyl)pentane-1,5-diamine (PubChem CID 62425905) has the molecular formula C13H27F3N2 and a molecular weight of 268.37 g/mol. Its IUPAC name is N-tert-butyl-N'-ethyl-N'-(2,2,2-trifluoroethyl)pentane-1,5-diamine.
| Compound Name | N-tert-butyl-N'-ethyl-N'-(2,2,2-trifluoroethyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 62425905 |
| Molecular Formula | C13H27F3N2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | N-tert-butyl-N'-ethyl-N'-(2,2,2-trifluoroethyl)pentane-1,5-diamine |
| SMILES | CCN(CCCCCNC(C)(C)C)CC(F)(F)F |
| InChI | InChI=1S/C13H27F3N2/c1-5-18(11-13(14,15)16)10-8-6-7-9-17-12(2,3)4/h17H,5-11H2,1-4H3 |
| InChIKey | VNGAAHHRFIAPRA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|