About 2-methylpentyl 3-amino-4-methylbenzoate
2-methylpentyl 3-amino-4-methylbenzoate (PubChem CID 62265210) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-methylpentyl 3-amino-4-methylbenzoate.
Molecular Properties
| Compound Name | 2-methylpentyl 3-amino-4-methylbenzoate |
| PubChem CID | 62265210 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-methylpentyl 3-amino-4-methylbenzoate |
| SMILES | CCCC(C)COC(=O)c1ccc(C)c(N)c1 |
| InChI | InChI=1S/C14H21NO2/c1-4-5-10(2)9-17-14(16)12-7-6-11(3)13(15)8-12/h6-8,10H,4-5,9,15H2,1-3H3 |
| InChIKey | QOULUBKIERKUOV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpentyl 3-amino-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpentyl 3-amino-4-methylbenzoate?
The IUPAC name of 2-methylpentyl 3-amino-4-methylbenzoate (CID 62265210) is 2-methylpentyl 3-amino-4-methylbenzoate.
What is the SMILES notation for 2-methylpentyl 3-amino-4-methylbenzoate?
The canonical SMILES for 2-methylpentyl 3-amino-4-methylbenzoate is CCCC(C)COC(=O)c1ccc(C)c(N)c1.
What is the InChIKey of 2-methylpentyl 3-amino-4-methylbenzoate?
The InChIKey is QOULUBKIERKUOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-4-5-10(2)9-17-14(16)12-7-6-11(3)13(15)8-12/h6-8,10H,4-5,9,15H2,1-3H3.
What are the key properties of 2-methylpentyl 3-amino-4-methylbenzoate?
2-methylpentyl 3-amino-4-methylbenzoate has a molecular weight of 235.33 g/mol, XLogP of 3.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpentyl 3-amino-4-methylbenzoate is sourced from PubChem (CID 62265210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).