C13H19N3O2S — CID 62267879
ethyl 2-(cyclopropylamino)-3-(4-methylpyrimidin-2-yl)sulfanylpropanoate (PubChem CID 62267879) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is ethyl 2-(cyclopropylamino)-3-(4-methylpyrimidin-2-yl)sulfanylpropanoate.
| Compound Name | ethyl 2-(cyclopropylamino)-3-(4-methylpyrimidin-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 62267879 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | ethyl 2-(cyclopropylamino)-3-(4-methylpyrimidin-2-yl)sulfanylpropanoate |
| SMILES | CCOC(=O)C(CSc1nccc(C)n1)NC1CC1 |
| InChI | InChI=1S/C13H19N3O2S/c1-3-18-12(17)11(16-10-4-5-10)8-19-13-14-7-6-9(2)15-13/h6-7,10-11,16H,3-5,8H2,1-2H3 |
| InChIKey | QXNFVBCKPDCMAI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |