C15H23N3O2S — CID 63919464
ethyl 2-cyclopropyl-2-(ethylamino)-3-(4-methylpyrimidin-2-yl)sulfanylpropanoate (PubChem CID 63919464) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is ethyl 2-cyclopropyl-2-(ethylamino)-3-(4-methylpyrimidin-2-yl)sulfanylpropanoate.
| Compound Name | ethyl 2-cyclopropyl-2-(ethylamino)-3-(4-methylpyrimidin-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 63919464 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | ethyl 2-cyclopropyl-2-(ethylamino)-3-(4-methylpyrimidin-2-yl)sulfanylpropanoate |
| SMILES | CCNC(CSc1nccc(C)n1)(C(=O)OCC)C1CC1 |
| InChI | InChI=1S/C15H23N3O2S/c1-4-17-15(12-6-7-12,13(19)20-5-2)10-21-14-16-9-8-11(3)18-14/h8-9,12,17H,4-7,10H2,1-3H3 |
| InChIKey | JNEIFGZYIYYURO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |