C15H21N3O2S — CID 63915943
ethyl 2-cyclopropyl-2-(cyclopropylamino)-3-pyrimidin-2-ylsulfanylpropanoate (PubChem CID 63915943) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is ethyl 2-cyclopropyl-2-(cyclopropylamino)-3-pyrimidin-2-ylsulfanylpropanoate.
| Compound Name | ethyl 2-cyclopropyl-2-(cyclopropylamino)-3-pyrimidin-2-ylsulfanylpropanoate |
|---|---|
| PubChem CID | 63915943 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | ethyl 2-cyclopropyl-2-(cyclopropylamino)-3-pyrimidin-2-ylsulfanylpropanoate |
| SMILES | CCOC(=O)C(CSc1ncccn1)(NC1CC1)C1CC1 |
| InChI | InChI=1S/C15H21N3O2S/c1-2-20-13(19)15(11-4-5-11,18-12-6-7-12)10-21-14-16-8-3-9-17-14/h3,8-9,11-12,18H,2,4-7,10H2,1H3 |
| InChIKey | CERBWFSOAHDGIQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |