C12H19N3O2S — CID 107781833
ethyl 2-cyclopropyl-3-(1H-imidazol-2-ylsulfanyl)-2-(methylamino)propanoate (PubChem CID 107781833) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is ethyl 2-cyclopropyl-3-(1H-imidazol-2-ylsulfanyl)-2-(methylamino)propanoate.
| Compound Name | ethyl 2-cyclopropyl-3-(1H-imidazol-2-ylsulfanyl)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 107781833 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | ethyl 2-cyclopropyl-3-(1H-imidazol-2-ylsulfanyl)-2-(methylamino)propanoate |
| SMILES | CCOC(=O)C(CSc1ncc[nH]1)(NC)C1CC1 |
| InChI | InChI=1S/C12H19N3O2S/c1-3-17-10(16)12(13-2,9-4-5-9)8-18-11-14-6-7-15-11/h6-7,9,13H,3-5,8H2,1-2H3,(H,14,15) |
| InChIKey | YNIWTGXZPYTDMN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |