C12H23NO3S — CID 66128328
ethyl 2-cyclopropyl-3-(3-hydroxypropylsulfanyl)-2-(methylamino)propanoate (PubChem CID 66128328) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is ethyl 2-cyclopropyl-3-(3-hydroxypropylsulfanyl)-2-(methylamino)propanoate.
| Compound Name | ethyl 2-cyclopropyl-3-(3-hydroxypropylsulfanyl)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 66128328 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | ethyl 2-cyclopropyl-3-(3-hydroxypropylsulfanyl)-2-(methylamino)propanoate |
| SMILES | CCOC(=O)C(CSCCCO)(NC)C1CC1 |
| InChI | InChI=1S/C12H23NO3S/c1-3-16-11(15)12(13-2,10-5-6-10)9-17-8-4-7-14/h10,13-14H,3-9H2,1-2H3 |
| InChIKey | YGQKMVKCNJGOER-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|