C12H23NO2S — CID 63917639
methyl 3-butylsulfanyl-2-cyclopropyl-2-(methylamino)propanoate (PubChem CID 63917639) has the molecular formula C12H23NO2S and a molecular weight of 245.39 g/mol. Its IUPAC name is methyl 3-butylsulfanyl-2-cyclopropyl-2-(methylamino)propanoate.
| Compound Name | methyl 3-butylsulfanyl-2-cyclopropyl-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 63917639 |
| Molecular Formula | C12H23NO2S |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | methyl 3-butylsulfanyl-2-cyclopropyl-2-(methylamino)propanoate |
| SMILES | CCCCSCC(NC)(C(=O)OC)C1CC1 |
| InChI | InChI=1S/C12H23NO2S/c1-4-5-8-16-9-12(13-2,10-6-7-10)11(14)15-3/h10,13H,4-9H2,1-3H3 |
| InChIKey | BKIDOEARCVCXQO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|