C13H25NO4S2 — CID 63919881
methyl 2-cyclopropyl-3-(2-methylsulfonylethylsulfanyl)-2-(propylamino)propanoate (PubChem CID 63919881) has the molecular formula C13H25NO4S2 and a molecular weight of 323.48 g/mol. Its IUPAC name is methyl 2-cyclopropyl-3-(2-methylsulfonylethylsulfanyl)-2-(propylamino)propanoate.
| Compound Name | methyl 2-cyclopropyl-3-(2-methylsulfonylethylsulfanyl)-2-(propylamino)propanoate |
|---|---|
| PubChem CID | 63919881 |
| Molecular Formula | C13H25NO4S2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | methyl 2-cyclopropyl-3-(2-methylsulfonylethylsulfanyl)-2-(propylamino)propanoate |
| SMILES | CCCNC(CSCCS(C)(=O)=O)(C(=O)OC)C1CC1 |
| InChI | InChI=1S/C13H25NO4S2/c1-4-7-14-13(11-5-6-11,12(15)18-2)10-19-8-9-20(3,16)17/h11,14H,4-10H2,1-3H3 |
| InChIKey | ZUXPPZCSUAKOFQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|