C12H22N2O3S — CID 114231919
methyl 2-cyclopropyl-2-(ethylamino)-3-[2-(methylamino)-2-oxoethyl]sulfanylpropanoate (PubChem CID 114231919) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is methyl 2-cyclopropyl-2-(ethylamino)-3-[2-(methylamino)-2-oxoethyl]sulfanylpropanoate.
| Compound Name | methyl 2-cyclopropyl-2-(ethylamino)-3-[2-(methylamino)-2-oxoethyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 114231919 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl 2-cyclopropyl-2-(ethylamino)-3-[2-(methylamino)-2-oxoethyl]sulfanylpropanoate |
| SMILES | CCNC(CSCC(=O)NC)(C(=O)OC)C1CC1 |
| InChI | InChI=1S/C12H22N2O3S/c1-4-14-12(9-5-6-9,11(16)17-3)8-18-7-10(15)13-2/h9,14H,4-8H2,1-3H3,(H,13,15) |
| InChIKey | WASSPDASGZHSLK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |