C13H20N4OS — CID 63918441
2-cyclopropyl-2-(propan-2-ylamino)-3-pyrimidin-2-ylsulfanylpropanamide (PubChem CID 63918441) has the molecular formula C13H20N4OS and a molecular weight of 280.40 g/mol. Its IUPAC name is 2-cyclopropyl-2-(propan-2-ylamino)-3-pyrimidin-2-ylsulfanylpropanamide.
| Compound Name | 2-cyclopropyl-2-(propan-2-ylamino)-3-pyrimidin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 63918441 |
| Molecular Formula | C13H20N4OS |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-cyclopropyl-2-(propan-2-ylamino)-3-pyrimidin-2-ylsulfanylpropanamide |
| SMILES | CC(C)NC(CSc1ncccn1)(C(N)=O)C1CC1 |
| InChI | InChI=1S/C13H20N4OS/c1-9(2)17-13(11(14)18,10-4-5-10)8-19-12-15-6-3-7-16-12/h3,6-7,9-10,17H,4-5,8H2,1-2H3,(H2,14,18) |
| InChIKey | HUDMFXIKCRHXTP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |