C14H21N3O3S — CID 63916873
methyl 2-cyclopropyl-3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-2-(propan-2-ylamino)propanoate (PubChem CID 63916873) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is methyl 2-cyclopropyl-3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-2-(propan-2-ylamino)propanoate.
| Compound Name | methyl 2-cyclopropyl-3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-2-(propan-2-ylamino)propanoate |
|---|---|
| PubChem CID | 63916873 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | methyl 2-cyclopropyl-3-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]-2-(propan-2-ylamino)propanoate |
| SMILES | COC(=O)C(CSc1nccc(=O)[nH]1)(NC(C)C)C1CC1 |
| InChI | InChI=1S/C14H21N3O3S/c1-9(2)17-14(10-4-5-10,12(19)20-3)8-21-13-15-7-6-11(18)16-13/h6-7,9-10,17H,4-5,8H2,1-3H3,(H,15,16,18) |
| InChIKey | XUDNQZNDEZUCJC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |