C11H10N2O3S — CID 62267988
5-[(6-amino-3-pyridinyl)sulfanylmethyl]furan-3-carboxylic acid (PubChem CID 62267988) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 5-[(6-amino-3-pyridinyl)sulfanylmethyl]furan-3-carboxylic acid.
| Compound Name | 5-[(6-amino-3-pyridinyl)sulfanylmethyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 62267988 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 5-[(6-amino-3-pyridinyl)sulfanylmethyl]furan-3-carboxylic acid |
| SMILES | Nc1ccc(SCc2cc(C(=O)O)co2)cn1 |
| InChI | InChI=1S/C11H10N2O3S/c12-10-2-1-9(4-13-10)17-6-8-3-7(5-16-8)11(14)15/h1-5H,6H2,(H2,12,13)(H,14,15) |
| InChIKey | MAUWAGSTBYYWTM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |