C17H36N2O — CID 62271713
3-[[1-[(tert-butylamino)methyl]cyclopentyl]methyl-propan-2-ylamino]propan-1-ol (PubChem CID 62271713) has the molecular formula C17H36N2O and a molecular weight of 284.49 g/mol. Its IUPAC name is 3-[[1-[(tert-butylamino)methyl]cyclopentyl]methyl-propan-2-ylamino]propan-1-ol.
| Compound Name | 3-[[1-[(tert-butylamino)methyl]cyclopentyl]methyl-propan-2-ylamino]propan-1-ol |
|---|---|
| PubChem CID | 62271713 |
| Molecular Formula | C17H36N2O |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | 3-[[1-[(tert-butylamino)methyl]cyclopentyl]methyl-propan-2-ylamino]propan-1-ol |
| SMILES | CC(C)N(CCCO)CC1(CNC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C17H36N2O/c1-15(2)19(11-8-12-20)14-17(9-6-7-10-17)13-18-16(3,4)5/h15,18,20H,6-14H2,1-5H3 |
| InChIKey | OHZDWTWLMRYVFA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |