C16H34N2O2 — CID 62392050
2-[[4-[(tert-butylamino)methyl]oxan-4-yl]methyl-propan-2-ylamino]ethanol (PubChem CID 62392050) has the molecular formula C16H34N2O2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-[[4-[(tert-butylamino)methyl]oxan-4-yl]methyl-propan-2-ylamino]ethanol.
| Compound Name | 2-[[4-[(tert-butylamino)methyl]oxan-4-yl]methyl-propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 62392050 |
| Molecular Formula | C16H34N2O2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | 2-[[4-[(tert-butylamino)methyl]oxan-4-yl]methyl-propan-2-ylamino]ethanol |
| SMILES | CC(C)N(CCO)CC1(CNC(C)(C)C)CCOCC1 |
| InChI | InChI=1S/C16H34N2O2/c1-14(2)18(8-9-19)13-16(6-10-20-11-7-16)12-17-15(3,4)5/h14,17,19H,6-13H2,1-5H3 |
| InChIKey | SDIPKMIAMFRDQF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |