C12H22F3NO — CID 62276407
2-Methyl-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]pentanal (PubChem CID 62276407) has the molecular formula C12H22F3NO and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-methyl-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]pentanal.
| Compound Name | 2-Methyl-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]pentanal |
|---|---|
| PubChem CID | 62276407 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-methyl-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]pentanal |
| SMILES | CCCC(C)(CN(CC(F)(F)F)C(C)C)C=O |
| InChI | InChI=1S/C12H22F3NO/c1-5-6-11(4,9-17)7-16(10(2)3)8-12(13,14)15/h9-10H,5-8H2,1-4H3 |
| InChIKey | UTMAQPMSWQINMG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | 240 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|