C11H20F3NO — CID 62276598
2-methyl-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]butanal (PubChem CID 62276598) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-methyl-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]butanal.
| Compound Name | 2-methyl-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]butanal |
|---|---|
| PubChem CID | 62276598 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-methyl-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]butanal |
| SMILES | CCC(C)(C=O)CN(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H20F3NO/c1-5-10(4,8-16)6-15(9(2)3)7-11(12,13)14/h8-9H,5-7H2,1-4H3 |
| InChIKey | ZFWOJIMPAFZGGC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|