C15H18N2OS — CID 62277752
2-methyl-3-[methyl(1,3-thiazol-4-ylmethyl)amino]-2-phenylpropanal (PubChem CID 62277752) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-methyl-3-[methyl(1,3-thiazol-4-ylmethyl)amino]-2-phenylpropanal.
| Compound Name | 2-methyl-3-[methyl(1,3-thiazol-4-ylmethyl)amino]-2-phenylpropanal |
|---|---|
| PubChem CID | 62277752 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-methyl-3-[methyl(1,3-thiazol-4-ylmethyl)amino]-2-phenylpropanal |
| SMILES | CN(Cc1cscn1)CC(C)(C=O)c1ccccc1 |
| InChI | InChI=1S/C15H18N2OS/c1-15(11-18,13-6-4-3-5-7-13)10-17(2)8-14-9-19-12-16-14/h3-7,9,11-12H,8,10H2,1-2H3 |
| InChIKey | UIWFTJFTYQLBBA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|