C15H13N3OS2 — CID 62765919
2-[methyl(1,3-thiazol-4-ylmethyl)amino]-4-phenyl-1,3-thiazole-5-carbaldehyde (PubChem CID 62765919) has the molecular formula C15H13N3OS2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-[methyl(1,3-thiazol-4-ylmethyl)amino]-4-phenyl-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[methyl(1,3-thiazol-4-ylmethyl)amino]-4-phenyl-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 62765919 |
| Molecular Formula | C15H13N3OS2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-[methyl(1,3-thiazol-4-ylmethyl)amino]-4-phenyl-1,3-thiazole-5-carbaldehyde |
| SMILES | CN(Cc1cscn1)c1nc(-c2ccccc2)c(C=O)s1 |
| InChI | InChI=1S/C15H13N3OS2/c1-18(7-12-9-20-10-16-12)15-17-14(13(8-19)21-15)11-5-3-2-4-6-11/h2-6,8-10H,7H2,1H3 |
| InChIKey | ARYDULRHSHURKN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|