About N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine
N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine (PubChem CID 62281360) has the molecular formula C17H18ClN3
and a molecular weight of 299.80 g/mol. Its IUPAC name is N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine |
| PubChem CID | 62281360 |
| Molecular Formula | C17H18ClN3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine |
| SMILES | Clc1cc(CNC2CC2)cnc1N1CCc2ccccc21 |
| InChI | InChI=1S/C17H18ClN3/c18-15-9-12(10-19-14-5-6-14)11-20-17(15)21-8-7-13-3-1-2-4-16(13)21/h1-4,9,11,14,19H,5-8,10H2 |
| InChIKey | JVQCFLOLHJVSPP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine?
The IUPAC name of N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine (CID 62281360) is N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine?
The canonical SMILES for N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine is Clc1cc(CNC2CC2)cnc1N1CCc2ccccc21.
What is the InChIKey of N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine?
The InChIKey is JVQCFLOLHJVSPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN3/c18-15-9-12(10-19-14-5-6-14)11-20-17(15)21-8-7-13-3-1-2-4-16(13)21/h1-4,9,11,14,19H,5-8,10H2.
What are the key properties of N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine?
N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine has a molecular weight of 299.80 g/mol, XLogP of 3.68, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-chloro-6-(2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]cyclopropanamine is sourced from PubChem (CID 62281360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).