C16H20N4S — CID 62287480
N-cyclopropyl-6-[(cyclopropylamino)methyl]-N-(thiophen-2-ylmethyl)pyridazin-3-amine (PubChem CID 62287480) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is N-cyclopropyl-6-[(cyclopropylamino)methyl]-N-(thiophen-2-ylmethyl)pyridazin-3-amine.
| Compound Name | N-cyclopropyl-6-[(cyclopropylamino)methyl]-N-(thiophen-2-ylmethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 62287480 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-cyclopropyl-6-[(cyclopropylamino)methyl]-N-(thiophen-2-ylmethyl)pyridazin-3-amine |
| SMILES | c1csc(CN(c2ccc(CNC3CC3)nn2)C2CC2)c1 |
| InChI | InChI=1S/C16H20N4S/c1-2-15(21-9-1)11-20(14-6-7-14)16-8-5-13(18-19-16)10-17-12-3-4-12/h1-2,5,8-9,12,14,17H,3-4,6-7,10-11H2 |
| InChIKey | UQCISXWIZRTQKK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |