C15H26ClN3 — CID 62293550
3-chloro-N-ethyl-N-(2-ethylbutyl)-5-(methylaminomethyl)pyridin-2-amine (PubChem CID 62293550) has the molecular formula C15H26ClN3 and a molecular weight of 283.85 g/mol. Its IUPAC name is 3-chloro-N-ethyl-N-(2-ethylbutyl)-5-(methylaminomethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-ethyl-N-(2-ethylbutyl)-5-(methylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 62293550 |
| Molecular Formula | C15H26ClN3 |
| Molecular Weight | 283.85 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 3-chloro-N-ethyl-N-(2-ethylbutyl)-5-(methylaminomethyl)pyridin-2-amine |
| SMILES | CCC(CC)CN(CC)c1ncc(CNC)cc1Cl |
| InChI | InChI=1S/C15H26ClN3/c1-5-12(6-2)11-19(7-3)15-14(16)8-13(9-17-4)10-18-15/h8,10,12,17H,5-7,9,11H2,1-4H3 |
| InChIKey | YFMIVYMQYOMZOX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |