C17H30ClN3 — CID 63490143
3-chloro-N,N-bis(2-methylpropyl)-5-(propylaminomethyl)pyridin-2-amine (PubChem CID 63490143) has the molecular formula C17H30ClN3 and a molecular weight of 311.90 g/mol. Its IUPAC name is 3-chloro-N,N-bis(2-methylpropyl)-5-(propylaminomethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N,N-bis(2-methylpropyl)-5-(propylaminomethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 63490143 |
| Molecular Formula | C17H30ClN3 |
| Molecular Weight | 311.90 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 3-chloro-N,N-bis(2-methylpropyl)-5-(propylaminomethyl)pyridin-2-amine |
| SMILES | CCCNCc1cnc(N(CC(C)C)CC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C17H30ClN3/c1-6-7-19-9-15-8-16(18)17(20-10-15)21(11-13(2)3)12-14(4)5/h8,10,13-14,19H,6-7,9,11-12H2,1-5H3 |
| InChIKey | FHCCPGHXBBYIRD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.90 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|