C15H26ClN3O — CID 79679769
1-[[3-chloro-5-(propylaminomethyl)-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine (PubChem CID 79679769) has the molecular formula C15H26ClN3O and a molecular weight of 299.85 g/mol. Its IUPAC name is 1-[[3-chloro-5-(propylaminomethyl)-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine.
| Compound Name | 1-[[3-chloro-5-(propylaminomethyl)-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine |
|---|---|
| PubChem CID | 79679769 |
| Molecular Formula | C15H26ClN3O |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 1-[[3-chloro-5-(propylaminomethyl)-2-pyridinyl]oxy]-N,N,2-trimethylpropan-2-amine |
| SMILES | CCCNCc1cnc(OCC(C)(C)N(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H26ClN3O/c1-6-7-17-9-12-8-13(16)14(18-10-12)20-11-15(2,3)19(4)5/h8,10,17H,6-7,9,11H2,1-5H3 |
| InChIKey | MQPNWSCCCMTPGM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|