C33H27N5O4 — CID 6229797
(Z)-N-[[2-(3,4-dimethoxyphenyl)-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaen-6-yl]methoxy]-1-phenylethanimine (PubChem CID 6229797) has the molecular formula C33H27N5O4 and a molecular weight of 557.61 g/mol. Its IUPAC name is (Z)-N-[[2-(3,4-dimethoxyphenyl)-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaen-6-yl]methoxy]-1-phenylethanimine.
| Compound Name | (Z)-N-[[2-(3,4-dimethoxyphenyl)-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaen-6-yl]methoxy]-1-phenylethanimine |
|---|---|
| PubChem CID | 6229797 |
| Molecular Formula | C33H27N5O4 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | (Z)-N-[[2-(3,4-dimethoxyphenyl)-12-oxa-5,7,8,10-tetrazapentacyclo[11.8.0.03,11.04,8.016,21]henicosa-1(13),3(11),4,6,9,14,16,18,20-nonaen-6-yl]methoxy]-1-phenylethanimine |
| SMILES | COc1ccc(C2c3c(ccc4ccccc34)Oc3ncn4nc(CO/N=C(/C)c5ccccc5)nc4c32)cc1OC |
| InChI | InChI=1S/C33H27N5O4/c1-20(21-9-5-4-6-10-21)37-41-18-28-35-32-31-29(23-14-15-25(39-2)27(17-23)40-3)30-24-12-8-7-11-22(24)13-16-26(30)42-33(31)34-19-38(32)36-28/h4-17,19,29H,18H2,1-3H3/b37-20- |
| InChIKey | ULGUCBOOIYZYPL-CLHYIUPASA-N |
| XLogP | 6.52 |
| TPSA | 92.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|