C33H30N2O6 — CID 6229940
(E)-[2-(3-ethoxy-4-hydroxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate (PubChem CID 6229940) has the molecular formula C33H30N2O6 and a molecular weight of 550.61 g/mol. Its IUPAC name is (E)-[2-(3-ethoxy-4-hydroxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate.
| Compound Name | (E)-[2-(3-ethoxy-4-hydroxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate |
|---|---|
| PubChem CID | 6229940 |
| Molecular Formula | C33H30N2O6 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | (E)-[2-(3-ethoxy-4-hydroxyphenyl)-4,5-dioxo-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate |
| SMILES | CCOc1cc(C2/C(=C(\[O-])c3ccc(OCc4cccc(C)c4)cc3)C(=O)C(=O)N2Cc2cc[nH+]cc2)ccc1O |
| InChI | InChI=1S/C33H30N2O6/c1-3-40-28-18-25(9-12-27(28)36)30-29(32(38)33(39)35(30)19-22-13-15-34-16-14-22)31(37)24-7-10-26(11-8-24)41-20-23-6-4-5-21(2)17-23/h4-18,30,36-37H,3,19-20H2,1-2H3/b31-29+ |
| InChIKey | YDGOORKFIPSNLR-OWWNRXNESA-N |
| XLogP | 3.92 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|