C29H24N2O5 — CID 4921441
[2-(furan-2-yl)-4,5-dioxo-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate (PubChem CID 4921441) has the molecular formula C29H24N2O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is [2-(furan-2-yl)-4,5-dioxo-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate.
| Compound Name | [2-(furan-2-yl)-4,5-dioxo-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate |
|---|---|
| PubChem CID | 4921441 |
| Molecular Formula | C29H24N2O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [2-(furan-2-yl)-4,5-dioxo-1-(pyridin-1-ium-4-ylmethyl)pyrrolidin-3-ylidene]-[4-[(3-methylphenyl)methoxy]phenyl]methanolate |
| SMILES | Cc1cccc(COc2ccc(C([O-])=C3C(=O)C(=O)N(Cc4cc[nH+]cc4)C3c3ccco3)cc2)c1 |
| InChI | InChI=1S/C29H24N2O5/c1-19-4-2-5-21(16-19)18-36-23-9-7-22(8-10-23)27(32)25-26(24-6-3-15-35-24)31(29(34)28(25)33)17-20-11-13-30-14-12-20/h2-16,26,32H,17-18H2,1H3 |
| InChIKey | KFZXIUQXTWHRDD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 96.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|