C17H24N2O2 — CID 62301111
6-[cyclobutyl(propylamino)methyl]-3-ethyl-1,3-benzoxazol-2-one (PubChem CID 62301111) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 6-[cyclobutyl(propylamino)methyl]-3-ethyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[cyclobutyl(propylamino)methyl]-3-ethyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 62301111 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 6-[cyclobutyl(propylamino)methyl]-3-ethyl-1,3-benzoxazol-2-one |
| SMILES | CCCNC(c1ccc2c(c1)oc(=O)n2CC)C1CCC1 |
| InChI | InChI=1S/C17H24N2O2/c1-3-10-18-16(12-6-5-7-12)13-8-9-14-15(11-13)21-17(20)19(14)4-2/h8-9,11-12,16,18H,3-7,10H2,1-2H3 |
| InChIKey | BMUUMRSIJFSXQF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |