C15H20N2O3 — CID 64867888
3-ethyl-6-[hydroxy(piperidin-2-yl)methyl]-1,3-benzoxazol-2-one (PubChem CID 64867888) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-ethyl-6-[hydroxy(piperidin-2-yl)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-ethyl-6-[hydroxy(piperidin-2-yl)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 64867888 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 3-ethyl-6-[hydroxy(piperidin-2-yl)methyl]-1,3-benzoxazol-2-one |
| SMILES | CCn1c(=O)oc2cc(C(O)C3CCCCN3)ccc21 |
| InChI | InChI=1S/C15H20N2O3/c1-2-17-12-7-6-10(9-13(12)20-15(17)19)14(18)11-5-3-4-8-16-11/h6-7,9,11,14,16,18H,2-5,8H2,1H3 |
| InChIKey | HAZRYQCEJLPZNF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |