C12H11F4NO3 — CID 79660190
3-ethyl-6-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-1,3-benzoxazol-2-one (PubChem CID 79660190) has the molecular formula C12H11F4NO3 and a molecular weight of 293.22 g/mol. Its IUPAC name is 3-ethyl-6-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-1,3-benzoxazol-2-one.
| Compound Name | 3-ethyl-6-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 79660190 |
| Molecular Formula | C12H11F4NO3 |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-ethyl-6-(2,2,3,3-tetrafluoro-1-hydroxypropyl)-1,3-benzoxazol-2-one |
| SMILES | CCn1c(=O)oc2cc(C(O)C(F)(F)C(F)F)ccc21 |
| InChI | InChI=1S/C12H11F4NO3/c1-2-17-7-4-3-6(5-8(7)20-11(17)19)9(18)12(15,16)10(13)14/h3-5,9-10,18H,2H2,1H3 |
| InChIKey | CXLXSYHLTDPJEJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|