C19H21NO — CID 62311521
N-[1-(1-but-2-ynoxynaphthalen-2-yl)ethyl]cyclopropanamine (PubChem CID 62311521) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[1-(1-but-2-ynoxynaphthalen-2-yl)ethyl]cyclopropanamine.
| Compound Name | N-[1-(1-but-2-ynoxynaphthalen-2-yl)ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 62311521 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[1-(1-but-2-ynoxynaphthalen-2-yl)ethyl]cyclopropanamine |
| SMILES | CC#CCOc1c(C(C)NC2CC2)ccc2ccccc12 |
| InChI | InChI=1S/C19H21NO/c1-3-4-13-21-19-17(14(2)20-16-10-11-16)12-9-15-7-5-6-8-18(15)19/h5-9,12,14,16,20H,10-11,13H2,1-2H3 |
| InChIKey | AIEQMOCFMXRQPL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|