C12H20N2 — CID 62311545
N-but-2-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine (PubChem CID 62311545) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-but-2-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine.
| Compound Name | N-but-2-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
|---|---|
| PubChem CID | 62311545 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-but-2-ynyl-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
| SMILES | CC#CCNC1CCN2CCCCC12 |
| InChI | InChI=1S/C12H20N2/c1-2-3-8-13-11-7-10-14-9-5-4-6-12(11)14/h11-13H,4-10H2,1H3 |
| InChIKey | WCFMAOOBSSVTKJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|