C14H23NO — CID 62320365
4-(3,5-dimethylphenyl)-1-methoxy-N-methylbutan-2-amine (PubChem CID 62320365) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-1-methoxy-N-methylbutan-2-amine.
| Compound Name | 4-(3,5-dimethylphenyl)-1-methoxy-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 62320365 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-1-methoxy-N-methylbutan-2-amine |
| SMILES | CNC(CCc1cc(C)cc(C)c1)COC |
| InChI | InChI=1S/C14H23NO/c1-11-7-12(2)9-13(8-11)5-6-14(15-3)10-16-4/h7-9,14-15H,5-6,10H2,1-4H3 |
| InChIKey | NTKNNXFHEGUMDH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |