C14H29N3O — CID 62325844
3-[[1-(aminomethyl)-4-methylcyclohexyl]-methylamino]-N-ethylpropanamide (PubChem CID 62325844) has the molecular formula C14H29N3O and a molecular weight of 255.41 g/mol. Its IUPAC name is 3-[[1-(aminomethyl)-4-methylcyclohexyl]-methylamino]-N-ethylpropanamide.
| Compound Name | 3-[[1-(aminomethyl)-4-methylcyclohexyl]-methylamino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 62325844 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | 3-[[1-(aminomethyl)-4-methylcyclohexyl]-methylamino]-N-ethylpropanamide |
| SMILES | CCNC(=O)CCN(C)C1(CN)CCC(C)CC1 |
| InChI | InChI=1S/C14H29N3O/c1-4-16-13(18)7-10-17(3)14(11-15)8-5-12(2)6-9-14/h12H,4-11,15H2,1-3H3,(H,16,18) |
| InChIKey | RZUOOSFAFVWURG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |