C14H26N2O3 — CID 65243197
2-[1-[[3-(ethylamino)-3-oxopropyl]-methylamino]cyclohexyl]acetic acid (PubChem CID 65243197) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-[1-[[3-(ethylamino)-3-oxopropyl]-methylamino]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[3-(ethylamino)-3-oxopropyl]-methylamino]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 65243197 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2-[1-[[3-(ethylamino)-3-oxopropyl]-methylamino]cyclohexyl]acetic acid |
| SMILES | CCNC(=O)CCN(C)C1(CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C14H26N2O3/c1-3-15-12(17)7-10-16(2)14(11-13(18)19)8-5-4-6-9-14/h3-11H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | TZZLHAGYDJSZIL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |