4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride

C14H18ClNO3S — CID 62331984

IUPAC4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride
SMILESCC1CCN(C(=O)c2ccc(S(=O)(=O)Cl)cc2)C(C)C1
InChIInChI=1S/C14H18ClNO3S/c1-10-7-8-16(11(2)9-10)14(17)12-3-5-13(6-4-12)20(15,18)19/h3-6,10-11H,7-9H2,1-2H3
InChIKeyVMOHOUNQKWTNTM-UHFFFAOYSA-N
MW315.82 g/mol
LogP2.87
Rot. Bonds2

About 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride

4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride (PubChem CID 62331984) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride.

Molecular Properties

Compound Name4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride
PubChem CID62331984
Molecular FormulaC14H18ClNO3S
Molecular Weight315.82 g/mol
Exact Mass315.07
IUPAC Name4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride
SMILESCC1CCN(C(=O)c2ccc(S(=O)(=O)Cl)cc2)C(C)C1
InChIInChI=1S/C14H18ClNO3S/c1-10-7-8-16(11(2)9-10)14(17)12-3-5-13(6-4-12)20(15,18)19/h3-6,10-11H,7-9H2,1-2H3
InChIKeyVMOHOUNQKWTNTM-UHFFFAOYSA-N
XLogP2.87
TPSA54.45 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500315.82
LogP ≤ 52.87
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride?
The IUPAC name of 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride (CID 62331984) is 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride.
What is the SMILES notation for 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride?
The canonical SMILES for 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride is CC1CCN(C(=O)c2ccc(S(=O)(=O)Cl)cc2)C(C)C1.
What is the InChIKey of 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride?
The InChIKey is VMOHOUNQKWTNTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO3S/c1-10-7-8-16(11(2)9-10)14(17)12-3-5-13(6-4-12)20(15,18)19/h3-6,10-11H,7-9H2,1-2H3.
What are the key properties of 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride?
4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride has a molecular weight of 315.82 g/mol, XLogP of 2.87, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride is sourced from PubChem (CID 62331984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).