C14H18ClNO3S — CID 62331984
4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride (PubChem CID 62331984) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride.
| Compound Name | 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 62331984 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-(2,4-dimethylpiperidine-1-carbonyl)benzenesulfonyl chloride |
| SMILES | CC1CCN(C(=O)c2ccc(S(=O)(=O)Cl)cc2)C(C)C1 |
| InChI | InChI=1S/C14H18ClNO3S/c1-10-7-8-16(11(2)9-10)14(17)12-3-5-13(6-4-12)20(15,18)19/h3-6,10-11H,7-9H2,1-2H3 |
| InChIKey | VMOHOUNQKWTNTM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |