C9H20N2O3S — CID 62333146
N-(2-hydroxypropyl)-N-methylpiperidine-1-sulfonamide (PubChem CID 62333146) has the molecular formula C9H20N2O3S and a molecular weight of 236.34 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-N-methylpiperidine-1-sulfonamide.
| Compound Name | N-(2-hydroxypropyl)-N-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 62333146 |
| Molecular Formula | C9H20N2O3S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | N-(2-hydroxypropyl)-N-methylpiperidine-1-sulfonamide |
| SMILES | CC(O)CN(C)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C9H20N2O3S/c1-9(12)8-10(2)15(13,14)11-6-4-3-5-7-11/h9,12H,3-8H2,1-2H3 |
| InChIKey | YFWKRSFWNGOSMY-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |