C12H17FN2O2 — CID 62335925
4-[2-(ethylamino)ethoxymethyl]-3-fluorobenzamide (PubChem CID 62335925) has the molecular formula C12H17FN2O2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 4-[2-(ethylamino)ethoxymethyl]-3-fluorobenzamide.
| Compound Name | 4-[2-(ethylamino)ethoxymethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 62335925 |
| Molecular Formula | C12H17FN2O2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 4-[2-(ethylamino)ethoxymethyl]-3-fluorobenzamide |
| SMILES | CCNCCOCc1ccc(C(N)=O)cc1F |
| InChI | InChI=1S/C12H17FN2O2/c1-2-15-5-6-17-8-10-4-3-9(12(14)16)7-11(10)13/h3-4,7,15H,2,5-6,8H2,1H3,(H2,14,16) |
| InChIKey | WFGZMPZYXMWUOL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|