C10H18N2O2 — CID 62337386
2-[1-(methylamino)propan-2-yloxy]-N-prop-2-ynylpropanamide (PubChem CID 62337386) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-[1-(methylamino)propan-2-yloxy]-N-prop-2-ynylpropanamide.
| Compound Name | 2-[1-(methylamino)propan-2-yloxy]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 62337386 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-[1-(methylamino)propan-2-yloxy]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)OC(C)CNC |
| InChI | InChI=1S/C10H18N2O2/c1-5-6-12-10(13)9(3)14-8(2)7-11-4/h1,8-9,11H,6-7H2,2-4H3,(H,12,13) |
| InChIKey | KEIIREKPHRIQEH-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|