C11H19N3O3S — CID 62337809
6-(ethylamino)-N-(2-hydroxypropyl)-N-methylpyridine-3-sulfonamide (PubChem CID 62337809) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 6-(ethylamino)-N-(2-hydroxypropyl)-N-methylpyridine-3-sulfonamide.
| Compound Name | 6-(ethylamino)-N-(2-hydroxypropyl)-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62337809 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 6-(ethylamino)-N-(2-hydroxypropyl)-N-methylpyridine-3-sulfonamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(C)CC(C)O)cn1 |
| InChI | InChI=1S/C11H19N3O3S/c1-4-12-11-6-5-10(7-13-11)18(16,17)14(3)8-9(2)15/h5-7,9,15H,4,8H2,1-3H3,(H,12,13) |
| InChIKey | SVYHBTFFIKLCMN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |