C10H13BrN2O — CID 62338959
N-(3-bromopropyl)-3-methylpyridine-2-carboxamide (PubChem CID 62338959) has the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. Its IUPAC name is N-(3-bromopropyl)-3-methylpyridine-2-carboxamide.
| Compound Name | N-(3-bromopropyl)-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 62338959 |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | N-(3-bromopropyl)-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cccnc1C(=O)NCCCBr |
| InChI | InChI=1S/C10H13BrN2O/c1-8-4-2-6-12-9(8)10(14)13-7-3-5-11/h2,4,6H,3,5,7H2,1H3,(H,13,14) |
| InChIKey | HYDGUUPDQVQRCK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|