C11H17N3OS2 — CID 163545247
N-[2-(2-aminoethyldisulfanyl)ethyl]-3-methylpyridine-2-carboxamide (PubChem CID 163545247) has the molecular formula C11H17N3OS2 and a molecular weight of 271.41 g/mol. Its IUPAC name is N-[2-(2-aminoethyldisulfanyl)ethyl]-3-methylpyridine-2-carboxamide.
| Compound Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 163545247 |
| Molecular Formula | C11H17N3OS2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cccnc1C(=O)NCCSSCCN |
| InChI | InChI=1S/C11H17N3OS2/c1-9-3-2-5-13-10(9)11(15)14-6-8-17-16-7-4-12/h2-3,5H,4,6-8,12H2,1H3,(H,14,15) |
| InChIKey | FEMNSRKYLIVPCV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|