C11H22N2O3 — CID 62339294
N,N-bis(2-hydroxyethyl)-3-methylpiperidine-2-carboxamide (PubChem CID 62339294) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3-methylpiperidine-2-carboxamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-3-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 62339294 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3-methylpiperidine-2-carboxamide |
| SMILES | CC1CCCNC1C(=O)N(CCO)CCO |
| InChI | InChI=1S/C11H22N2O3/c1-9-3-2-4-12-10(9)11(16)13(5-7-14)6-8-15/h9-10,12,14-15H,2-8H2,1H3 |
| InChIKey | VYKALWUGOYNQTA-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |